C30H35ClN6O2S — CID 88987091
1-[3-[4-[(3Z,5Z)-6-amino-2-methylidenehexa-3,5-dienoxy]-3-chloroanilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-2-(diethylaminomethyl)prop-2-en-1-one (PubChem CID 88987091) has the molecular formula C30H35ClN6O2S and a molecular weight of 579.17 g/mol. Its IUPAC name is 1-[3-[4-[(3Z,5Z)-6-amino-2-methylidenehexa-3,5-dienoxy]-3-chloroanilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-2-(diethylaminomethyl)prop-2-en-1-one.
| Compound Name | 1-[3-[4-[(3Z,5Z)-6-amino-2-methylidenehexa-3,5-dienoxy]-3-chloroanilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-2-(diethylaminomethyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 88987091 |
| Molecular Formula | C30H35ClN6O2S |
| Molecular Weight | 579.17 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | 1-[3-[4-[(3Z,5Z)-6-amino-2-methylidenehexa-3,5-dienoxy]-3-chloroanilino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]-2-(diethylaminomethyl)prop-2-en-1-one |
| SMILES | C=C(/C=C\C=C/N)COc1ccc(Nc2ncnc3sc4c(c23)CCN(C(=O)C(=C)CN(CC)CC)C4)cc1Cl |
| InChI | InChI=1S/C30H35ClN6O2S/c1-5-36(6-2)16-21(4)30(38)37-14-12-23-26(17-37)40-29-27(23)28(33-19-34-29)35-22-10-11-25(24(31)15-22)39-18-20(3)9-7-8-13-32/h7-11,13,15,19H,3-6,12,14,16-18,32H2,1-2H3,(H,33,34,35)/b9-7-,13-8- |
| InChIKey | YGPKMLUGDUESGD-XFSHKZRWSA-N |
| XLogP | 5.83 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.17 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|