C17H18N4O3S2 — CID 1157296
4-methoxy-N'-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzenesulfonohydrazide (PubChem CID 1157296) has the molecular formula C17H18N4O3S2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 4-methoxy-N'-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzenesulfonohydrazide.
| Compound Name | 4-methoxy-N'-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 1157296 |
| Molecular Formula | C17H18N4O3S2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 4-methoxy-N'-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzenesulfonohydrazide |
| SMILES | COc1ccc(S(=O)(=O)NNc2ncnc3sc4c(c23)CCCC4)cc1 |
| InChI | InChI=1S/C17H18N4O3S2/c1-24-11-6-8-12(9-7-11)26(22,23)21-20-16-15-13-4-2-3-5-14(13)25-17(15)19-10-18-16/h6-10,21H,2-5H2,1H3,(H,18,19,20) |
| InChIKey | KOYLCFMIKZOWHV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|