C21H25N5O3S2 — CID 21011549
1-butyl-3-[4-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)phenyl]sulfonylurea (PubChem CID 21011549) has the molecular formula C21H25N5O3S2 and a molecular weight of 459.60 g/mol. Its IUPAC name is 1-butyl-3-[4-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)phenyl]sulfonylurea.
| Compound Name | 1-butyl-3-[4-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)phenyl]sulfonylurea |
|---|---|
| PubChem CID | 21011549 |
| Molecular Formula | C21H25N5O3S2 |
| Molecular Weight | 459.60 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 1-butyl-3-[4-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylamino)phenyl]sulfonylurea |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1ccc(Nc2ncnc3sc4c(c23)CCCC4)cc1 |
| InChI | InChI=1S/C21H25N5O3S2/c1-2-3-12-22-21(27)26-31(28,29)15-10-8-14(9-11-15)25-19-18-16-6-4-5-7-17(16)30-20(18)24-13-23-19/h8-11,13H,2-7,12H2,1H3,(H2,22,26,27)(H,23,24,25) |
| InChIKey | LJNJLFPXNHWJOZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|