C17H23N3O2S — CID 133350026
methyl 2,2,3-trimethyl-3-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)butanoate (PubChem CID 133350026) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is methyl 2,2,3-trimethyl-3-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)butanoate.
| Compound Name | methyl 2,2,3-trimethyl-3-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)butanoate |
|---|---|
| PubChem CID | 133350026 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | methyl 2,2,3-trimethyl-3-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)butanoate |
| SMILES | COC(=O)C(C)(C)C(C)(C)Nc1ncnc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C17H23N3O2S/c1-16(2,15(21)22-5)17(3,4)20-13-12-10-7-6-8-11(10)23-14(12)19-9-18-13/h9H,6-8H2,1-5H3,(H,18,19,20) |
| InChIKey | FMRZDFGMGQIMLC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |