C14H28O2 — CID 23080767
2,3,3,4-tetramethyldec-1-ene-1,1-diol (PubChem CID 23080767) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 2,3,3,4-tetramethyldec-1-ene-1,1-diol.
| Compound Name | 2,3,3,4-tetramethyldec-1-ene-1,1-diol |
|---|---|
| PubChem CID | 23080767 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 2,3,3,4-tetramethyldec-1-ene-1,1-diol |
| SMILES | CCCCCCC(C)C(C)(C)C(C)=C(O)O |
| InChI | InChI=1S/C14H28O2/c1-6-7-8-9-10-11(2)14(4,5)12(3)13(15)16/h11,15-16H,6-10H2,1-5H3 |
| InChIKey | AKCHPPZEPSHOIW-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|