C15H33NO2 — CID 173175122
acetic acid;2,3-dimethylundecan-2-amine (PubChem CID 173175122) has the molecular formula C15H33NO2 and a molecular weight of 259.43 g/mol. Its IUPAC name is acetic acid;2,3-dimethylundecan-2-amine.
| Compound Name | acetic acid;2,3-dimethylundecan-2-amine |
|---|---|
| PubChem CID | 173175122 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | acetic acid;2,3-dimethylundecan-2-amine |
| SMILES | CC(=O)O.CCCCCCCCC(C)C(C)(C)N |
| InChI | InChI=1S/C13H29N.C2H4O2/c1-5-6-7-8-9-10-11-12(2)13(3,4)14;1-2(3)4/h12H,5-11,14H2,1-4H3;1H3,(H,3,4) |
| InChIKey | ZLWFFCOQDPDUOU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|