C15H33NO2 — CID 173175223
2,3-dimethyldecan-2-amine;propanoic acid (PubChem CID 173175223) has the molecular formula C15H33NO2 and a molecular weight of 259.43 g/mol. Its IUPAC name is 2,3-dimethyldecan-2-amine;propanoic acid.
| Compound Name | 2,3-dimethyldecan-2-amine;propanoic acid |
|---|---|
| PubChem CID | 173175223 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | 2,3-dimethyldecan-2-amine;propanoic acid |
| SMILES | CCC(=O)O.CCCCCCCC(C)C(C)(C)N |
| InChI | InChI=1S/C12H27N.C3H6O2/c1-5-6-7-8-9-10-11(2)12(3,4)13;1-2-3(4)5/h11H,5-10,13H2,1-4H3;2H2,1H3,(H,4,5) |
| InChIKey | FNKAKAHYHYUHOQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|