C13H31NO4S — CID 170436301
2,3-dimethylundecan-2-amine;sulfuric acid (PubChem CID 170436301) has the molecular formula C13H31NO4S and a molecular weight of 297.46 g/mol. Its IUPAC name is 2,3-dimethylundecan-2-amine;sulfuric acid.
| Compound Name | 2,3-dimethylundecan-2-amine;sulfuric acid |
|---|---|
| PubChem CID | 170436301 |
| Molecular Formula | C13H31NO4S |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 2,3-dimethylundecan-2-amine;sulfuric acid |
| SMILES | CCCCCCCCC(C)C(C)(C)N.O=S(=O)(O)O |
| InChI | InChI=1S/C13H29N.H2O4S/c1-5-6-7-8-9-10-11-12(2)13(3,4)14;1-5(2,3)4/h12H,5-11,14H2,1-4H3;(H2,1,2,3,4) |
| InChIKey | ZPMHHYJVDQCPFW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|