C16H27N3O2 — CID 23084178
tert-butyl 4-[(2-ethylimidazol-1-yl)methyl]piperidine-1-carboxylate (PubChem CID 23084178) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is tert-butyl 4-[(2-ethylimidazol-1-yl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-ethylimidazol-1-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23084178 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | tert-butyl 4-[(2-ethylimidazol-1-yl)methyl]piperidine-1-carboxylate |
| SMILES | CCc1nccn1CC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H27N3O2/c1-5-14-17-8-11-19(14)12-13-6-9-18(10-7-13)15(20)21-16(2,3)4/h8,11,13H,5-7,9-10,12H2,1-4H3 |
| InChIKey | QUEDVTFSRWMBDF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |