C16H16NO5- — CID 2308564
(2R,3S)-3-hydroxy-2-[(2-naphthalen-1-yloxyacetyl)amino]butanoate (PubChem CID 2308564) has the molecular formula C16H16NO5- and a molecular weight of 302.31 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2-[(2-naphthalen-1-yloxyacetyl)amino]butanoate.
| Compound Name | (2R,3S)-3-hydroxy-2-[(2-naphthalen-1-yloxyacetyl)amino]butanoate |
|---|---|
| PubChem CID | 2308564 |
| Molecular Formula | C16H16NO5- |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (2R,3S)-3-hydroxy-2-[(2-naphthalen-1-yloxyacetyl)amino]butanoate |
| SMILES | C[C@H](O)[C@@H](NC(=O)COc1cccc2ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C16H17NO5/c1-10(18)15(16(20)21)17-14(19)9-22-13-8-4-6-11-5-2-3-7-12(11)13/h2-8,10,15,18H,9H2,1H3,(H,17,19)(H,20,21)/p-1/t10-,15+/m0/s1 |
| InChIKey | LPXIKJFFJRVELW-ZUZCIYMTSA-M |
| XLogP | -0.17 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |