C8H16N2OS — CID 23090486
N-methyl-2-thiomorpholin-3-ylpropanamide (PubChem CID 23090486) has the molecular formula C8H16N2OS and a molecular weight of 188.30 g/mol. Its IUPAC name is N-methyl-2-thiomorpholin-3-ylpropanamide.
| Compound Name | N-methyl-2-thiomorpholin-3-ylpropanamide |
|---|---|
| PubChem CID | 23090486 |
| Molecular Formula | C8H16N2OS |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | N-methyl-2-thiomorpholin-3-ylpropanamide |
| SMILES | CNC(=O)C(C)C1CSCCN1 |
| InChI | InChI=1S/C8H16N2OS/c1-6(8(11)9-2)7-5-12-4-3-10-7/h6-7,10H,3-5H2,1-2H3,(H,9,11) |
| InChIKey | DMLFNNDIDNOECJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |