C18H13F3N2O2S2 — CID 23093997
3-(pyridin-4-ylmethylsulfanyl)-N-[3-(trifluoromethoxy)phenyl]thiophene-2-carboxamide (PubChem CID 23093997) has the molecular formula C18H13F3N2O2S2 and a molecular weight of 410.44 g/mol. Its IUPAC name is 3-(pyridin-4-ylmethylsulfanyl)-N-[3-(trifluoromethoxy)phenyl]thiophene-2-carboxamide.
| Compound Name | 3-(pyridin-4-ylmethylsulfanyl)-N-[3-(trifluoromethoxy)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 23093997 |
| Molecular Formula | C18H13F3N2O2S2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 3-(pyridin-4-ylmethylsulfanyl)-N-[3-(trifluoromethoxy)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cccc(OC(F)(F)F)c1)c1sccc1SCc1ccncc1 |
| InChI | InChI=1S/C18H13F3N2O2S2/c19-18(20,21)25-14-3-1-2-13(10-14)23-17(24)16-15(6-9-26-16)27-11-12-4-7-22-8-5-12/h1-10H,11H2,(H,23,24) |
| InChIKey | BIWYREYBGHKXQT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |