C32H38CaCl2N2O8 — CID 23094355
calcium bis(4-[[(3-chlorophenyl)methoxycarbonylamino]methyl]cyclohexane-1-carboxylate) (PubChem CID 23094355) has the molecular formula C32H38CaCl2N2O8 and a molecular weight of 689.65 g/mol. Its IUPAC name is calcium bis(4-[[(3-chlorophenyl)methoxycarbonylamino]methyl]cyclohexane-1-carboxylate).
| Compound Name | calcium bis(4-[[(3-chlorophenyl)methoxycarbonylamino]methyl]cyclohexane-1-carboxylate) |
|---|---|
| PubChem CID | 23094355 |
| Molecular Formula | C32H38CaCl2N2O8 |
| Molecular Weight | 689.65 g/mol |
| Exact Mass | 688.16 |
| IUPAC Name | calcium bis(4-[[(3-chlorophenyl)methoxycarbonylamino]methyl]cyclohexane-1-carboxylate) |
| SMILES | O=C(NCC1CCC(C(=O)[O-])CC1)OCc1cccc(Cl)c1.O=C(NCC1CCC(C(=O)[O-])CC1)OCc1cccc(Cl)c1.[Ca+2] |
| InChI | InChI=1S/2C16H20ClNO4.Ca/c2*17-14-3-1-2-12(8-14)10-22-16(21)18-9-11-4-6-13(7-5-11)15(19)20;/h2*1-3,8,11,13H,4-7,9-10H2,(H,18,21)(H,19,20);/q;;+2/p-2 |
| InChIKey | CWBHCSOOLWPRKU-UHFFFAOYSA-L |
| XLogP | 3.86 |
| TPSA | 156.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.65 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |