C24H25N3O4S2 — CID 23098287
ethyl 2-[2-(4-aminophenyl)sulfanylpropanoylamino]-4-methyl-5-(phenylcarbamoyl)thiophene-3-carboxylate (PubChem CID 23098287) has the molecular formula C24H25N3O4S2 and a molecular weight of 483.62 g/mol. Its IUPAC name is ethyl 2-[2-(4-aminophenyl)sulfanylpropanoylamino]-4-methyl-5-(phenylcarbamoyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-(4-aminophenyl)sulfanylpropanoylamino]-4-methyl-5-(phenylcarbamoyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23098287 |
| Molecular Formula | C24H25N3O4S2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | ethyl 2-[2-(4-aminophenyl)sulfanylpropanoylamino]-4-methyl-5-(phenylcarbamoyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(C)Sc2ccc(N)cc2)sc(C(=O)Nc2ccccc2)c1C |
| InChI | InChI=1S/C24H25N3O4S2/c1-4-31-24(30)19-14(2)20(22(29)26-17-8-6-5-7-9-17)33-23(19)27-21(28)15(3)32-18-12-10-16(25)11-13-18/h5-13,15H,4,25H2,1-3H3,(H,26,29)(H,27,28) |
| InChIKey | RSORKRCBVRSURY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|