C22H20N4O2S2 — CID 22780535
5-[2-(4-aminophenyl)sulfanylpropanoylamino]-4-cyano-3-methyl-N-phenylthiophene-2-carboxamide (PubChem CID 22780535) has the molecular formula C22H20N4O2S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 5-[2-(4-aminophenyl)sulfanylpropanoylamino]-4-cyano-3-methyl-N-phenylthiophene-2-carboxamide.
| Compound Name | 5-[2-(4-aminophenyl)sulfanylpropanoylamino]-4-cyano-3-methyl-N-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 22780535 |
| Molecular Formula | C22H20N4O2S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 5-[2-(4-aminophenyl)sulfanylpropanoylamino]-4-cyano-3-methyl-N-phenylthiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2)sc(NC(=O)C(C)Sc2ccc(N)cc2)c1C#N |
| InChI | InChI=1S/C22H20N4O2S2/c1-13-18(12-23)22(30-19(13)21(28)25-16-6-4-3-5-7-16)26-20(27)14(2)29-17-10-8-15(24)9-11-17/h3-11,14H,24H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | DQRNUTIPSYNCJP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|