C15H13N5O3S — CID 53275050
5-[[(2E)-2-amino-2-hydroxyiminoacetyl]amino]-4-cyano-3-methyl-N-phenylthiophene-2-carboxamide (PubChem CID 53275050) has the molecular formula C15H13N5O3S and a molecular weight of 343.37 g/mol. Its IUPAC name is 5-[[(2E)-2-amino-2-hydroxyiminoacetyl]amino]-4-cyano-3-methyl-N-phenylthiophene-2-carboxamide.
| Compound Name | 5-[[(2E)-2-amino-2-hydroxyiminoacetyl]amino]-4-cyano-3-methyl-N-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 53275050 |
| Molecular Formula | C15H13N5O3S |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 5-[[(2E)-2-amino-2-hydroxyiminoacetyl]amino]-4-cyano-3-methyl-N-phenylthiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2)sc(NC(=O)/C(N)=N\O)c1C#N |
| InChI | InChI=1S/C15H13N5O3S/c1-8-10(7-16)15(19-14(22)12(17)20-23)24-11(8)13(21)18-9-5-3-2-4-6-9/h2-6,23H,1H3,(H2,17,20)(H,18,21)(H,19,22) |
| InChIKey | XNANOUNGLCJBPL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 140.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|