C25H25N3OS — CID 23102337
[4-(2,5-dimethylphenyl)piperazin-1-yl]-phenothiazin-10-ylmethanone (PubChem CID 23102337) has the molecular formula C25H25N3OS and a molecular weight of 415.56 g/mol. Its IUPAC name is [4-(2,5-dimethylphenyl)piperazin-1-yl]-phenothiazin-10-ylmethanone.
| Compound Name | [4-(2,5-dimethylphenyl)piperazin-1-yl]-phenothiazin-10-ylmethanone |
|---|---|
| PubChem CID | 23102337 |
| Molecular Formula | C25H25N3OS |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | [4-(2,5-dimethylphenyl)piperazin-1-yl]-phenothiazin-10-ylmethanone |
| SMILES | Cc1ccc(C)c(N2CCN(C(=O)N3c4ccccc4Sc4ccccc43)CC2)c1 |
| InChI | InChI=1S/C25H25N3OS/c1-18-11-12-19(2)22(17-18)26-13-15-27(16-14-26)25(29)28-20-7-3-5-9-23(20)30-24-10-6-4-8-21(24)28/h3-12,17H,13-16H2,1-2H3 |
| InChIKey | ULYCUAZVSJTQJF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |