C27H32N4O3S — CID 46390643
2-[4-[4-(2,5-dimethylphenyl)piperazine-1-carbonyl]piperidine-1-carbonyl]-4H-1,4-benzothiazin-3-one (PubChem CID 46390643) has the molecular formula C27H32N4O3S and a molecular weight of 492.65 g/mol. Its IUPAC name is 2-[4-[4-(2,5-dimethylphenyl)piperazine-1-carbonyl]piperidine-1-carbonyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | 2-[4-[4-(2,5-dimethylphenyl)piperazine-1-carbonyl]piperidine-1-carbonyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 46390643 |
| Molecular Formula | C27H32N4O3S |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | 2-[4-[4-(2,5-dimethylphenyl)piperazine-1-carbonyl]piperidine-1-carbonyl]-4H-1,4-benzothiazin-3-one |
| SMILES | Cc1ccc(C)c(N2CCN(C(=O)C3CCN(C(=O)C4Sc5ccccc5NC4=O)CC3)CC2)c1 |
| InChI | InChI=1S/C27H32N4O3S/c1-18-7-8-19(2)22(17-18)29-13-15-31(16-14-29)26(33)20-9-11-30(12-10-20)27(34)24-25(32)28-21-5-3-4-6-23(21)35-24/h3-8,17,20,24H,9-16H2,1-2H3,(H,28,32) |
| InChIKey | VZQPPMLRIGQEDZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|