C23H25N3O5S — CID 46390622
N-(3,5-dimethoxyphenyl)-1-(3-oxo-4H-1,4-benzothiazine-2-carbonyl)piperidine-4-carboxamide (PubChem CID 46390622) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-1-(3-oxo-4H-1,4-benzothiazine-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(3,5-dimethoxyphenyl)-1-(3-oxo-4H-1,4-benzothiazine-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46390622 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-1-(3-oxo-4H-1,4-benzothiazine-2-carbonyl)piperidine-4-carboxamide |
| SMILES | COc1cc(NC(=O)C2CCN(C(=O)C3Sc4ccccc4NC3=O)CC2)cc(OC)c1 |
| InChI | InChI=1S/C23H25N3O5S/c1-30-16-11-15(12-17(13-16)31-2)24-21(27)14-7-9-26(10-8-14)23(29)20-22(28)25-18-5-3-4-6-19(18)32-20/h3-6,11-14,20H,7-10H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | JWUPAHFQGZMKCH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|