C22H19ClN4O3S2 — CID 92883320
N-(6-chloro-1,3-benzothiazol-2-yl)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-4-carboxamide (PubChem CID 92883320) has the molecular formula C22H19ClN4O3S2 and a molecular weight of 487.01 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92883320 |
| Molecular Formula | C22H19ClN4O3S2 |
| Molecular Weight | 487.01 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1nc2ccc(Cl)cc2s1)C1CCN(C(=O)[C@H]2Sc3ccccc3NC2=O)CC1 |
| InChI | InChI=1S/C22H19ClN4O3S2/c23-13-5-6-15-17(11-13)32-22(25-15)26-19(28)12-7-9-27(10-8-12)21(30)18-20(29)24-14-3-1-2-4-16(14)31-18/h1-6,11-12,18H,7-10H2,(H,24,29)(H,25,26,28)/t18-/m0/s1 |
| InChIKey | UWTQHNASTKLTDY-SFHVURJKSA-N |
| XLogP | 4.24 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.01 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|