C21H21N3O3S — CID 92883443
1-[(2R)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]-N-phenylpiperidine-4-carboxamide (PubChem CID 92883443) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 1-[(2R)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]-N-phenylpiperidine-4-carboxamide.
| Compound Name | 1-[(2R)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]-N-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 92883443 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 1-[(2R)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]-N-phenylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCN(C(=O)[C@@H]2Sc3ccccc3NC2=O)CC1 |
| InChI | InChI=1S/C21H21N3O3S/c25-19(22-15-6-2-1-3-7-15)14-10-12-24(13-11-14)21(27)18-20(26)23-16-8-4-5-9-17(16)28-18/h1-9,14,18H,10-13H2,(H,22,25)(H,23,26)/t18-/m1/s1 |
| InChIKey | QCGCKYOPXPYWGJ-GOSISDBHSA-N |
| XLogP | 2.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|