C22H22FN3O3S — CID 92896584
(3R)-N-(3-fluoro-4-methylphenyl)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-3-carboxamide (PubChem CID 92896584) has the molecular formula C22H22FN3O3S and a molecular weight of 427.50 g/mol. Its IUPAC name is (3R)-N-(3-fluoro-4-methylphenyl)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-(3-fluoro-4-methylphenyl)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92896584 |
| Molecular Formula | C22H22FN3O3S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (3R)-N-(3-fluoro-4-methylphenyl)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CCCN(C(=O)[C@H]3Sc4ccccc4NC3=O)C2)cc1F |
| InChI | InChI=1S/C22H22FN3O3S/c1-13-8-9-15(11-16(13)23)24-20(27)14-5-4-10-26(12-14)22(29)19-21(28)25-17-6-2-3-7-18(17)30-19/h2-3,6-9,11,14,19H,4-5,10,12H2,1H3,(H,24,27)(H,25,28)/t14-,19+/m1/s1 |
| InChIKey | VXKVPOZYPOVGNI-KUHUBIRLSA-N |
| XLogP | 3.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|