C23H25N3O3S — CID 92896549
(3S)-N-(2,4-dimethylphenyl)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-3-carboxamide (PubChem CID 92896549) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is (3S)-N-(2,4-dimethylphenyl)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-(2,4-dimethylphenyl)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92896549 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (3S)-N-(2,4-dimethylphenyl)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2CCCN(C(=O)[C@H]3Sc4ccccc4NC3=O)C2)c(C)c1 |
| InChI | InChI=1S/C23H25N3O3S/c1-14-9-10-17(15(2)12-14)24-21(27)16-6-5-11-26(13-16)23(29)20-22(28)25-18-7-3-4-8-19(18)30-20/h3-4,7-10,12,16,20H,5-6,11,13H2,1-2H3,(H,24,27)(H,25,28)/t16-,20-/m0/s1 |
| InChIKey | GRKDSRVJBOVZLZ-JXFKEZNVSA-N |
| XLogP | 3.59 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|