C23H25N3O4S — CID 92896565
(3S)-N-[(2-methoxyphenyl)methyl]-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-3-carboxamide (PubChem CID 92896565) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is (3S)-N-[(2-methoxyphenyl)methyl]-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-[(2-methoxyphenyl)methyl]-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92896565 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (3S)-N-[(2-methoxyphenyl)methyl]-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-3-carboxamide |
| SMILES | COc1ccccc1CNC(=O)[C@H]1CCCN(C(=O)[C@H]2Sc3ccccc3NC2=O)C1 |
| InChI | InChI=1S/C23H25N3O4S/c1-30-18-10-4-2-7-15(18)13-24-21(27)16-8-6-12-26(14-16)23(29)20-22(28)25-17-9-3-5-11-19(17)31-20/h2-5,7,9-11,16,20H,6,8,12-14H2,1H3,(H,24,27)(H,25,28)/t16-,20-/m0/s1 |
| InChIKey | LULSDMJAMPUUAF-JXFKEZNVSA-N |
| XLogP | 2.66 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|