C25H29N3O5S — CID 92883283
N-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(2R)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-4-carboxamide (PubChem CID 92883283) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(2R)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(2R)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92883283 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(2R)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2CCN(C(=O)[C@@H]3Sc4ccccc4NC3=O)CC2)cc1OC |
| InChI | InChI=1S/C25H29N3O5S/c1-32-19-8-7-16(15-20(19)33-2)9-12-26-23(29)17-10-13-28(14-11-17)25(31)22-24(30)27-18-5-3-4-6-21(18)34-22/h3-8,15,17,22H,9-14H2,1-2H3,(H,26,29)(H,27,30)/t22-/m1/s1 |
| InChIKey | HFAIBYKZPUMPFD-JOCHJYFZSA-N |
| XLogP | 2.71 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|