C22H29N3O3S — CID 46390618
N-cycloheptyl-1-(3-oxo-4H-1,4-benzothiazine-2-carbonyl)piperidine-4-carboxamide (PubChem CID 46390618) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-cycloheptyl-1-(3-oxo-4H-1,4-benzothiazine-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-cycloheptyl-1-(3-oxo-4H-1,4-benzothiazine-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46390618 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-cycloheptyl-1-(3-oxo-4H-1,4-benzothiazine-2-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(NC1CCCCCC1)C1CCN(C(=O)C2Sc3ccccc3NC2=O)CC1 |
| InChI | InChI=1S/C22H29N3O3S/c26-20(23-16-7-3-1-2-4-8-16)15-11-13-25(14-12-15)22(28)19-21(27)24-17-9-5-6-10-18(17)29-19/h5-6,9-10,15-16,19H,1-4,7-8,11-14H2,(H,23,26)(H,24,27) |
| InChIKey | BXUPQTXPYFGGSP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|