C23H24ClN3O5S — CID 92883268
N-(5-chloro-2,4-dimethoxyphenyl)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-4-carboxamide (PubChem CID 92883268) has the molecular formula C23H24ClN3O5S and a molecular weight of 489.98 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-4-carboxamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92883268 |
| Molecular Formula | C23H24ClN3O5S |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]piperidine-4-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)C2CCN(C(=O)[C@H]3Sc4ccccc4NC3=O)CC2)cc1Cl |
| InChI | InChI=1S/C23H24ClN3O5S/c1-31-17-12-18(32-2)16(11-14(17)24)26-21(28)13-7-9-27(10-8-13)23(30)20-22(29)25-15-5-3-4-6-19(15)33-20/h3-6,11-13,20H,7-10H2,1-2H3,(H,25,29)(H,26,28)/t20-/m0/s1 |
| InChIKey | VFTRKQZLGQGEGH-FQEVSTJZSA-N |
| XLogP | 3.65 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|