C20H21N3O3S2 — CID 92883470
(3S)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide (PubChem CID 92883470) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is (3S)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92883470 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | (3S)-1-[(2S)-3-oxo-4H-1,4-benzothiazine-2-carbonyl]-N-(thiophen-2-ylmethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1cccs1)[C@H]1CCCN(C(=O)[C@H]2Sc3ccccc3NC2=O)C1 |
| InChI | InChI=1S/C20H21N3O3S2/c24-18(21-11-14-6-4-10-27-14)13-5-3-9-23(12-13)20(26)17-19(25)22-15-7-1-2-8-16(15)28-17/h1-2,4,6-8,10,13,17H,3,5,9,11-12H2,(H,21,24)(H,22,25)/t13-,17-/m0/s1 |
| InChIKey | HYJOKDFQJTUPMT-GUYCJALGSA-N |
| XLogP | 2.72 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|