C6H11N3 — CID 23104077
N,1,3-trimethylimidazol-2-imine (PubChem CID 23104077) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is N,1,3-trimethylimidazol-2-imine.
| Compound Name | N,1,3-trimethylimidazol-2-imine |
|---|---|
| PubChem CID | 23104077 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | N,1,3-trimethylimidazol-2-imine |
| SMILES | CN=c1n(C)ccn1C |
| InChI | InChI=1S/C6H11N3/c1-7-6-8(2)4-5-9(6)3/h4-5H,1-3H3 |
| InChIKey | IZFXQOFKCPZZBE-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 22.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |