C24H33NO3 — CID 23105820
2-[(dimethylamino)methyl]-1-[(3-methoxyphenyl)methyl]-4-phenylmethoxycyclohexan-1-ol (PubChem CID 23105820) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-1-[(3-methoxyphenyl)methyl]-4-phenylmethoxycyclohexan-1-ol.
| Compound Name | 2-[(dimethylamino)methyl]-1-[(3-methoxyphenyl)methyl]-4-phenylmethoxycyclohexan-1-ol |
|---|---|
| PubChem CID | 23105820 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | 2-[(dimethylamino)methyl]-1-[(3-methoxyphenyl)methyl]-4-phenylmethoxycyclohexan-1-ol |
| SMILES | COc1cccc(CC2(O)CCC(OCc3ccccc3)CC2CN(C)C)c1 |
| InChI | InChI=1S/C24H33NO3/c1-25(2)17-21-15-23(28-18-19-8-5-4-6-9-19)12-13-24(21,26)16-20-10-7-11-22(14-20)27-3/h4-11,14,21,23,26H,12-13,15-18H2,1-3H3 |
| InChIKey | DMMDQOPPMRYIRG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |