C22H27F2NO2 — CID 23105880
2-[(dimethylamino)methyl]-1-(3-fluorophenyl)-4-[(4-fluorophenyl)methoxy]cyclohexan-1-ol (PubChem CID 23105880) has the molecular formula C22H27F2NO2 and a molecular weight of 375.46 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-1-(3-fluorophenyl)-4-[(4-fluorophenyl)methoxy]cyclohexan-1-ol.
| Compound Name | 2-[(dimethylamino)methyl]-1-(3-fluorophenyl)-4-[(4-fluorophenyl)methoxy]cyclohexan-1-ol |
|---|---|
| PubChem CID | 23105880 |
| Molecular Formula | C22H27F2NO2 |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 2-[(dimethylamino)methyl]-1-(3-fluorophenyl)-4-[(4-fluorophenyl)methoxy]cyclohexan-1-ol |
| SMILES | CN(C)CC1CC(OCc2ccc(F)cc2)CCC1(O)c1cccc(F)c1 |
| InChI | InChI=1S/C22H27F2NO2/c1-25(2)14-18-13-21(27-15-16-6-8-19(23)9-7-16)10-11-22(18,26)17-4-3-5-20(24)12-17/h3-9,12,18,21,26H,10-11,13-15H2,1-2H3 |
| InChIKey | IFBQAIHVSMIWRY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |