C15H15BrN2O3S — CID 23108103
5-bromo-2-[[3-[(dimethylamino)methyl]benzoyl]amino]thiophene-3-carboxylic acid (PubChem CID 23108103) has the molecular formula C15H15BrN2O3S and a molecular weight of 383.27 g/mol. Its IUPAC name is 5-bromo-2-[[3-[(dimethylamino)methyl]benzoyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 5-bromo-2-[[3-[(dimethylamino)methyl]benzoyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 23108103 |
| Molecular Formula | C15H15BrN2O3S |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 5-bromo-2-[[3-[(dimethylamino)methyl]benzoyl]amino]thiophene-3-carboxylic acid |
| SMILES | CN(C)Cc1cccc(C(=O)Nc2sc(Br)cc2C(=O)O)c1 |
| InChI | InChI=1S/C15H15BrN2O3S/c1-18(2)8-9-4-3-5-10(6-9)13(19)17-14-11(15(20)21)7-12(16)22-14/h3-7H,8H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | VHPSFAQLYZFFTM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |