C33H35N5O2 — CID 23109461
1,3-dibenzyl-8-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 23109461) has the molecular formula C33H35N5O2 and a molecular weight of 533.68 g/mol. Its IUPAC name is 1,3-dibenzyl-8-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1,3-dibenzyl-8-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 23109461 |
| Molecular Formula | C33H35N5O2 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | 1,3-dibenzyl-8-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CN1CCC2(CC1)C(=O)N(Cc1ccccc1)C(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C33H35N5O2/c1-25-30(26(2)38(34-25)29-16-10-5-11-17-29)24-35-20-18-33(19-21-35)31(39)36(22-27-12-6-3-7-13-27)32(40)37(33)23-28-14-8-4-9-15-28/h3-17H,18-24H2,1-2H3 |
| InChIKey | UXZBHIWVMAUWHG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|