C18H18ClNO4 — CID 23111201
(2E,4Z)-5-chloro-5-(7-methoxy-1-benzofuran-2-yl)-1-morpholin-4-ylpenta-2,4-dien-1-one (PubChem CID 23111201) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is (2E,4Z)-5-chloro-5-(7-methoxy-1-benzofuran-2-yl)-1-morpholin-4-ylpenta-2,4-dien-1-one.
| Compound Name | (2E,4Z)-5-chloro-5-(7-methoxy-1-benzofuran-2-yl)-1-morpholin-4-ylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 23111201 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (2E,4Z)-5-chloro-5-(7-methoxy-1-benzofuran-2-yl)-1-morpholin-4-ylpenta-2,4-dien-1-one |
| SMILES | COc1cccc2cc(/C(Cl)=C/C=C/C(=O)N3CCOCC3)oc12 |
| InChI | InChI=1S/C18H18ClNO4/c1-22-15-6-2-4-13-12-16(24-18(13)15)14(19)5-3-7-17(21)20-8-10-23-11-9-20/h2-7,12H,8-11H2,1H3/b7-3+,14-5- |
| InChIKey | VPAFNWPFKUFOTF-QBRRSIRKSA-N |
| XLogP | 3.44 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|