C25H23O4- — CID 23111673
2-[6-[(3-phenoxyphenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]acetate (PubChem CID 23111673) has the molecular formula C25H23O4- and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-[6-[(3-phenoxyphenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]acetate.
| Compound Name | 2-[6-[(3-phenoxyphenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]acetate |
|---|---|
| PubChem CID | 23111673 |
| Molecular Formula | C25H23O4- |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-[6-[(3-phenoxyphenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]acetate |
| SMILES | O=C([O-])CC1CCCc2cc(OCc3cccc(Oc4ccccc4)c3)ccc21 |
| InChI | InChI=1S/C25H24O4/c26-25(27)16-20-8-5-7-19-15-22(12-13-24(19)20)28-17-18-6-4-11-23(14-18)29-21-9-2-1-3-10-21/h1-4,6,9-15,20H,5,7-8,16-17H2,(H,26,27)/p-1 |
| InChIKey | VJRSNJDZYQDFAJ-UHFFFAOYSA-M |
| XLogP | 4.62 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |