C19H21F2N2O2+ — CID 2311589
2-fluoro-N-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]benzamide (PubChem CID 2311589) has the molecular formula C19H21F2N2O2+ and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-fluoro-N-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]benzamide.
| Compound Name | 2-fluoro-N-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]benzamide |
|---|---|
| PubChem CID | 2311589 |
| Molecular Formula | C19H21F2N2O2+ |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-fluoro-N-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]benzamide |
| SMILES | O=C(NC[C@H](c1ccc(F)cc1)[NH+]1CCOCC1)c1ccccc1F |
| InChI | InChI=1S/C19H20F2N2O2/c20-15-7-5-14(6-8-15)18(23-9-11-25-12-10-23)13-22-19(24)16-3-1-2-4-17(16)21/h1-8,18H,9-13H2,(H,22,24)/p+1/t18-/m1/s1 |
| InChIKey | GIPIKFWBXWJOFP-GOSISDBHSA-O |
| XLogP | 1.35 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |