C18H20ClFN3O2+ — CID 2313698
2-chloro-N-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]pyridine-3-carboxamide (PubChem CID 2313698) has the molecular formula C18H20ClFN3O2+ and a molecular weight of 364.83 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 2313698 |
| Molecular Formula | C18H20ClFN3O2+ |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-chloro-N-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]pyridine-3-carboxamide |
| SMILES | O=C(NC[C@H](c1ccc(F)cc1)[NH+]1CCOCC1)c1cccnc1Cl |
| InChI | InChI=1S/C18H19ClFN3O2/c19-17-15(2-1-7-21-17)18(24)22-12-16(23-8-10-25-11-9-23)13-3-5-14(20)6-4-13/h1-7,16H,8-12H2,(H,22,24)/p+1/t16-/m1/s1 |
| InChIKey | PBRPZAGLXWTGEW-MRXNPFEDSA-O |
| XLogP | 1.26 |
| TPSA | 55.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|