C18H26O4 — CID 23116198
2-[2-[2-ethyl-3,5-bis(prop-2-enoxy)phenyl]ethoxy]ethanol (PubChem CID 23116198) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 2-[2-[2-ethyl-3,5-bis(prop-2-enoxy)phenyl]ethoxy]ethanol.
| Compound Name | 2-[2-[2-ethyl-3,5-bis(prop-2-enoxy)phenyl]ethoxy]ethanol |
|---|---|
| PubChem CID | 23116198 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-[2-[2-ethyl-3,5-bis(prop-2-enoxy)phenyl]ethoxy]ethanol |
| SMILES | C=CCOc1cc(CCOCCO)c(CC)c(OCC=C)c1 |
| InChI | InChI=1S/C18H26O4/c1-4-9-21-16-13-15(7-11-20-12-8-19)17(6-3)18(14-16)22-10-5-2/h4-5,13-14,19H,1-2,6-12H2,3H3 |
| InChIKey | RGEXSIHXXZKKJA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|