C15H16F3NO4 — CID 23117773
2-[(3,4,5-trifluoro-N-pentan-3-ylanilino)methylidene]propanedioic acid (PubChem CID 23117773) has the molecular formula C15H16F3NO4 and a molecular weight of 331.29 g/mol. Its IUPAC name is 2-[(3,4,5-trifluoro-N-pentan-3-ylanilino)methylidene]propanedioic acid.
| Compound Name | 2-[(3,4,5-trifluoro-N-pentan-3-ylanilino)methylidene]propanedioic acid |
|---|---|
| PubChem CID | 23117773 |
| Molecular Formula | C15H16F3NO4 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-[(3,4,5-trifluoro-N-pentan-3-ylanilino)methylidene]propanedioic acid |
| SMILES | CCC(CC)N(C=C(C(=O)O)C(=O)O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H16F3NO4/c1-3-8(4-2)19(7-10(14(20)21)15(22)23)9-5-11(16)13(18)12(17)6-9/h5-8H,3-4H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | VTHZLACZBQYQBF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|