C27H29N3O6S2Si — CID 23119984
2-trimethylsilylethyl 3-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)thiophen-2-yl]-2,4-dioxo-1H-quinazoline-5-carboxylate (PubChem CID 23119984) has the molecular formula C27H29N3O6S2Si and a molecular weight of 583.76 g/mol. Its IUPAC name is 2-trimethylsilylethyl 3-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)thiophen-2-yl]-2,4-dioxo-1H-quinazoline-5-carboxylate.
| Compound Name | 2-trimethylsilylethyl 3-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)thiophen-2-yl]-2,4-dioxo-1H-quinazoline-5-carboxylate |
|---|---|
| PubChem CID | 23119984 |
| Molecular Formula | C27H29N3O6S2Si |
| Molecular Weight | 583.76 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | 2-trimethylsilylethyl 3-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)thiophen-2-yl]-2,4-dioxo-1H-quinazoline-5-carboxylate |
| SMILES | C[Si](C)(C)CCOC(=O)c1cccc2[nH]c(=O)n(-c3cc(S(=O)(=O)N4CCCc5ccccc54)cs3)c(=O)c12 |
| InChI | InChI=1S/C27H29N3O6S2Si/c1-39(2,3)15-14-36-26(32)20-10-6-11-21-24(20)25(31)30(27(33)28-21)23-16-19(17-37-23)38(34,35)29-13-7-9-18-8-4-5-12-22(18)29/h4-6,8,10-12,16-17H,7,9,13-15H2,1-3H3,(H,28,33) |
| InChIKey | YENSFKXSCRGBTO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.76 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|