C24H20N4O5S — CID 86609978
3-[3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-5-(hydroxyiminomethyl)-1H-quinazoline-2,4-dione (PubChem CID 86609978) has the molecular formula C24H20N4O5S and a molecular weight of 476.51 g/mol. Its IUPAC name is 3-[3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-5-(hydroxyiminomethyl)-1H-quinazoline-2,4-dione.
| Compound Name | 3-[3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-5-(hydroxyiminomethyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 86609978 |
| Molecular Formula | C24H20N4O5S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 3-[3-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-5-(hydroxyiminomethyl)-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2cccc(C=NO)c2c(=O)n1-c1cccc(S(=O)(=O)N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C24H20N4O5S/c29-23-22-17(15-25-31)7-3-11-20(22)26-24(30)28(23)18-9-4-10-19(14-18)34(32,33)27-13-5-8-16-6-1-2-12-21(16)27/h1-4,6-7,9-12,14-15,31H,5,8,13H2,(H,26,30) |
| InChIKey | DNUSGKORGHSYGM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 124.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|