About 2-methyldodecan-5-yl dihydrogen phosphate
2-methyldodecan-5-yl dihydrogen phosphate (PubChem CID 23120845) has the molecular formula C13H29O4P
and a molecular weight of 280.34 g/mol. Its IUPAC name is 2-methyldodecan-5-yl dihydrogen phosphate.
Molecular Properties
| Compound Name | 2-methyldodecan-5-yl dihydrogen phosphate |
| PubChem CID | 23120845 |
| Molecular Formula | C13H29O4P |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-methyldodecan-5-yl dihydrogen phosphate |
| SMILES | CCCCCCCC(CCC(C)C)OP(=O)(O)O |
| InChI | InChI=1S/C13H29O4P/c1-4-5-6-7-8-9-13(11-10-12(2)3)17-18(14,15)16/h12-13H,4-11H2,1-3H3,(H2,14,15,16) |
| InChIKey | WNIRIHLVAJJVNE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methyldodecan-5-yl dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyldodecan-5-yl dihydrogen phosphate?
The IUPAC name of 2-methyldodecan-5-yl dihydrogen phosphate (CID 23120845) is 2-methyldodecan-5-yl dihydrogen phosphate.
What is the SMILES notation for 2-methyldodecan-5-yl dihydrogen phosphate?
The canonical SMILES for 2-methyldodecan-5-yl dihydrogen phosphate is CCCCCCCC(CCC(C)C)OP(=O)(O)O.
What is the InChIKey of 2-methyldodecan-5-yl dihydrogen phosphate?
The InChIKey is WNIRIHLVAJJVNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29O4P/c1-4-5-6-7-8-9-13(11-10-12(2)3)17-18(14,15)16/h12-13H,4-11H2,1-3H3,(H2,14,15,16).
What are the key properties of 2-methyldodecan-5-yl dihydrogen phosphate?
2-methyldodecan-5-yl dihydrogen phosphate has a molecular weight of 280.34 g/mol, XLogP of 4.26, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyldodecan-5-yl dihydrogen phosphate is sourced from PubChem (CID 23120845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).