C19H28Cl6P2 — CID 23122187
[phenyl(6,6,6-trichlorohexylphosphanyl)methyl]-(6,6,6-trichlorohexyl)phosphane (PubChem CID 23122187) has the molecular formula C19H28Cl6P2 and a molecular weight of 531.10 g/mol. Its IUPAC name is [phenyl(6,6,6-trichlorohexylphosphanyl)methyl]-(6,6,6-trichlorohexyl)phosphane.
| Compound Name | [phenyl(6,6,6-trichlorohexylphosphanyl)methyl]-(6,6,6-trichlorohexyl)phosphane |
|---|---|
| PubChem CID | 23122187 |
| Molecular Formula | C19H28Cl6P2 |
| Molecular Weight | 531.10 g/mol |
| Exact Mass | 527.98 |
| IUPAC Name | [phenyl(6,6,6-trichlorohexylphosphanyl)methyl]-(6,6,6-trichlorohexyl)phosphane |
| SMILES | ClC(Cl)(Cl)CCCCCPC(PCCCCCC(Cl)(Cl)Cl)c1ccccc1 |
| InChI | InChI=1S/C19H28Cl6P2/c20-18(21,22)12-6-2-8-14-26-17(16-10-4-1-5-11-16)27-15-9-3-7-13-19(23,24)25/h1,4-5,10-11,17,26-27H,2-3,6-9,12-15H2 |
| InChIKey | PTBAGEHSBSJDFZ-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.10 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|