C9H6F7N — CID 23123821
2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-methylpyridine (PubChem CID 23123821) has the molecular formula C9H6F7N and a molecular weight of 261.14 g/mol. Its IUPAC name is 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-methylpyridine.
| Compound Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-methylpyridine |
|---|---|
| PubChem CID | 23123821 |
| Molecular Formula | C9H6F7N |
| Molecular Weight | 261.14 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-4-methylpyridine |
| SMILES | Cc1ccnc(C(F)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H6F7N/c1-5-2-3-17-6(4-5)7(10,8(11,12)13)9(14,15)16/h2-4H,1H3 |
| InChIKey | ZSZXAUVJKZPLII-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.14 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |