C12H18F3NOSi — CID 124637255
trimethyl-[(2S)-1,1,1-trifluoro-2-(4-methyl-2-pyridinyl)propan-2-yl]oxysilane (PubChem CID 124637255) has the molecular formula C12H18F3NOSi and a molecular weight of 277.36 g/mol. Its IUPAC name is trimethyl-[(2S)-1,1,1-trifluoro-2-(4-methyl-2-pyridinyl)propan-2-yl]oxysilane.
| Compound Name | trimethyl-[(2S)-1,1,1-trifluoro-2-(4-methyl-2-pyridinyl)propan-2-yl]oxysilane |
|---|---|
| PubChem CID | 124637255 |
| Molecular Formula | C12H18F3NOSi |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | trimethyl-[(2S)-1,1,1-trifluoro-2-(4-methyl-2-pyridinyl)propan-2-yl]oxysilane |
| SMILES | Cc1ccnc([C@](C)(O[Si](C)(C)C)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H18F3NOSi/c1-9-6-7-16-10(8-9)11(2,12(13,14)15)17-18(3,4)5/h6-8H,1-5H3/t11-/m0/s1 |
| InChIKey | ILQARIAGCLEPBC-NSHDSACASA-N |
| XLogP | 4.02 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|