C30H34N2O4 — CID 23127016
2-[4-[2-[benzyl-(2-hydroxy-3-phenoxypropyl)amino]ethyl]phenoxy]-N-methyl-N-prop-2-ynylacetamide (PubChem CID 23127016) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is 2-[4-[2-[benzyl-(2-hydroxy-3-phenoxypropyl)amino]ethyl]phenoxy]-N-methyl-N-prop-2-ynylacetamide.
| Compound Name | 2-[4-[2-[benzyl-(2-hydroxy-3-phenoxypropyl)amino]ethyl]phenoxy]-N-methyl-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 23127016 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 2-[4-[2-[benzyl-(2-hydroxy-3-phenoxypropyl)amino]ethyl]phenoxy]-N-methyl-N-prop-2-ynylacetamide |
| SMILES | C#CCN(C)C(=O)COc1ccc(CCN(Cc2ccccc2)CC(O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C30H34N2O4/c1-3-19-31(2)30(34)24-36-29-16-14-25(15-17-29)18-20-32(21-26-10-6-4-7-11-26)22-27(33)23-35-28-12-8-5-9-13-28/h1,4-17,27,33H,18-24H2,2H3 |
| InChIKey | ZFENNZIAGQLXDQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|