C14H8N2S3 — CID 2312882
2-(1,3-dithiol-2-ylidene)-2-(4-phenyl-1,3-thiazol-2-yl)acetonitrile (PubChem CID 2312882) has the molecular formula C14H8N2S3 and a molecular weight of 300.43 g/mol. Its IUPAC name is 2-(1,3-dithiol-2-ylidene)-2-(4-phenyl-1,3-thiazol-2-yl)acetonitrile.
| Compound Name | 2-(1,3-dithiol-2-ylidene)-2-(4-phenyl-1,3-thiazol-2-yl)acetonitrile |
|---|---|
| PubChem CID | 2312882 |
| Molecular Formula | C14H8N2S3 |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 2-(1,3-dithiol-2-ylidene)-2-(4-phenyl-1,3-thiazol-2-yl)acetonitrile |
| SMILES | N#CC(=C1SC=CS1)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C14H8N2S3/c15-8-11(14-17-6-7-18-14)13-16-12(9-19-13)10-4-2-1-3-5-10/h1-7,9H |
| InChIKey | BGQJFBVOWLWREJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|