C20H20FN3O2S — CID 23134043
1-[1-(3-fluorophenoxy)-3-methylsulfanylpropan-2-yl]-3-isoquinolin-5-ylurea (PubChem CID 23134043) has the molecular formula C20H20FN3O2S and a molecular weight of 385.46 g/mol. Its IUPAC name is 1-[1-(3-fluorophenoxy)-3-methylsulfanylpropan-2-yl]-3-isoquinolin-5-ylurea.
| Compound Name | 1-[1-(3-fluorophenoxy)-3-methylsulfanylpropan-2-yl]-3-isoquinolin-5-ylurea |
|---|---|
| PubChem CID | 23134043 |
| Molecular Formula | C20H20FN3O2S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 1-[1-(3-fluorophenoxy)-3-methylsulfanylpropan-2-yl]-3-isoquinolin-5-ylurea |
| SMILES | CSCC(COc1cccc(F)c1)NC(=O)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C20H20FN3O2S/c1-27-13-16(12-26-17-6-3-5-15(21)10-17)23-20(25)24-19-7-2-4-14-11-22-9-8-18(14)19/h2-11,16H,12-13H2,1H3,(H2,23,24,25) |
| InChIKey | OHPFNGOSSUETOD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |