C11H20N2 — CID 23135270
2,9-diazaspiro[6.6]tridec-4-ene (PubChem CID 23135270) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 2,9-diazaspiro[6.6]tridec-4-ene.
| Compound Name | 2,9-diazaspiro[6.6]tridec-4-ene |
|---|---|
| PubChem CID | 23135270 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 2,9-diazaspiro[6.6]tridec-4-ene |
| SMILES | C1=CCC2(CCCCNC2)CNC1 |
| InChI | InChI=1S/C11H20N2/c1-3-7-12-9-11(5-1)6-2-4-8-13-10-11/h1,3,12-13H,2,4-10H2 |
| InChIKey | MFWCPOZPUPDTBP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|