C20H20F2N2O3S — CID 23135289
9-(2,5-difluorophenyl)sulfonyl-2-phenyl-2,9-diazaspiro[4.5]decan-1-one (PubChem CID 23135289) has the molecular formula C20H20F2N2O3S and a molecular weight of 406.45 g/mol. Its IUPAC name is 9-(2,5-difluorophenyl)sulfonyl-2-phenyl-2,9-diazaspiro[4.5]decan-1-one.
| Compound Name | 9-(2,5-difluorophenyl)sulfonyl-2-phenyl-2,9-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 23135289 |
| Molecular Formula | C20H20F2N2O3S |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 9-(2,5-difluorophenyl)sulfonyl-2-phenyl-2,9-diazaspiro[4.5]decan-1-one |
| SMILES | O=C1N(c2ccccc2)CCC12CCCN(S(=O)(=O)c1cc(F)ccc1F)C2 |
| InChI | InChI=1S/C20H20F2N2O3S/c21-15-7-8-17(22)18(13-15)28(26,27)23-11-4-9-20(14-23)10-12-24(19(20)25)16-5-2-1-3-6-16/h1-3,5-8,13H,4,9-12,14H2 |
| InChIKey | QFIUGPBPMSAPSC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |